C18H21NO4S — CID 7851016
N-[(3R)-1,1-dioxothiolan-3-yl]-N-ethyl-2-naphthalen-1-yloxyacetamide (PubChem CID 7851016) has the molecular formula C18H21NO4S and a molecular weight of 347.44 g/mol. Its IUPAC name is N-[(3R)-1,1-dioxothiolan-3-yl]-N-ethyl-2-naphthalen-1-yloxyacetamide.
| Compound Name | N-[(3R)-1,1-dioxothiolan-3-yl]-N-ethyl-2-naphthalen-1-yloxyacetamide |
|---|---|
| PubChem CID | 7851016 |
| Molecular Formula | C18H21NO4S |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.12 |
| IUPAC Name | N-[(3R)-1,1-dioxothiolan-3-yl]-N-ethyl-2-naphthalen-1-yloxyacetamide |
| SMILES | CCN(C(=O)COc1cccc2ccccc12)[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C18H21NO4S/c1-2-19(15-10-11-24(21,22)13-15)18(20)12-23-17-9-5-7-14-6-3-4-8-16(14)17/h3-9,15H,2,10-13H2,1H3/t15-/m1/s1 |
| InChIKey | MGXAUCZPRBFBST-OAHLLOKOSA-N |
| XLogP | 2.25 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |