C20H23NO6S — CID 9009895
N-[(3R)-1,1-dioxothiolan-3-yl]-2-(1-formylnaphthalen-2-yl)oxy-N-(2-methoxyethyl)acetamide (PubChem CID 9009895) has the molecular formula C20H23NO6S and a molecular weight of 405.47 g/mol. Its IUPAC name is N-[(3R)-1,1-dioxothiolan-3-yl]-2-(1-formylnaphthalen-2-yl)oxy-N-(2-methoxyethyl)acetamide.
| Compound Name | N-[(3R)-1,1-dioxothiolan-3-yl]-2-(1-formylnaphthalen-2-yl)oxy-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 9009895 |
| Molecular Formula | C20H23NO6S |
| Molecular Weight | 405.47 g/mol |
| Exact Mass | 405.12 |
| IUPAC Name | N-[(3R)-1,1-dioxothiolan-3-yl]-2-(1-formylnaphthalen-2-yl)oxy-N-(2-methoxyethyl)acetamide |
| SMILES | COCCN(C(=O)COc1ccc2ccccc2c1C=O)[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C20H23NO6S/c1-26-10-9-21(16-8-11-28(24,25)14-16)20(23)13-27-19-7-6-15-4-2-3-5-17(15)18(19)12-22/h2-7,12,16H,8-11,13-14H2,1H3/t16-/m1/s1 |
| InChIKey | MVEDZVBZIYLBPO-MRXNPFEDSA-N |
| XLogP | 1.69 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.47 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|