C20H32N2O7S — CID 108869814
1-(1,1-dioxothiolan-3-yl)-1-(2-methoxyethyl)-3-(3,4,5-triethoxyphenyl)urea (PubChem CID 108869814) has the molecular formula C20H32N2O7S and a molecular weight of 444.55 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-1-(2-methoxyethyl)-3-(3,4,5-triethoxyphenyl)urea.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-1-(2-methoxyethyl)-3-(3,4,5-triethoxyphenyl)urea |
|---|---|
| PubChem CID | 108869814 |
| Molecular Formula | C20H32N2O7S |
| Molecular Weight | 444.55 g/mol |
| Exact Mass | 444.19 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-1-(2-methoxyethyl)-3-(3,4,5-triethoxyphenyl)urea |
| SMILES | CCOc1cc(NC(=O)N(CCOC)C2CCS(=O)(=O)C2)cc(OCC)c1OCC |
| InChI | InChI=1S/C20H32N2O7S/c1-5-27-17-12-15(13-18(28-6-2)19(17)29-7-3)21-20(23)22(9-10-26-4)16-8-11-30(24,25)14-16/h12-13,16H,5-11,14H2,1-4H3,(H,21,23) |
| InChIKey | SUDXOKWKAFFRGC-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 103.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.55 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |