C15H19BrN2O5S — CID 108527263
N-(3-bromophenyl)-N'-(1,1-dioxothiolan-3-yl)-N'-(2-methoxyethyl)oxamide (PubChem CID 108527263) has the molecular formula C15H19BrN2O5S and a molecular weight of 419.30 g/mol. Its IUPAC name is N-(3-bromophenyl)-N'-(1,1-dioxothiolan-3-yl)-N'-(2-methoxyethyl)oxamide.
| Compound Name | N-(3-bromophenyl)-N'-(1,1-dioxothiolan-3-yl)-N'-(2-methoxyethyl)oxamide |
|---|---|
| PubChem CID | 108527263 |
| Molecular Formula | C15H19BrN2O5S |
| Molecular Weight | 419.30 g/mol |
| Exact Mass | 418.02 |
| IUPAC Name | N-(3-bromophenyl)-N'-(1,1-dioxothiolan-3-yl)-N'-(2-methoxyethyl)oxamide |
| SMILES | COCCN(C(=O)C(=O)Nc1cccc(Br)c1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C15H19BrN2O5S/c1-23-7-6-18(13-5-8-24(21,22)10-13)15(20)14(19)17-12-4-2-3-11(16)9-12/h2-4,9,13H,5-8,10H2,1H3,(H,17,19) |
| InChIKey | IPOOFUHPHRLHHX-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.30 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|