C17H25N3O4S — CID 108515684
N'-[2-(dimethylamino)ethyl]-N'-(1,1-dioxothiolan-3-yl)-N-(3-methylphenyl)oxamide (PubChem CID 108515684) has the molecular formula C17H25N3O4S and a molecular weight of 367.47 g/mol. Its IUPAC name is N'-[2-(dimethylamino)ethyl]-N'-(1,1-dioxothiolan-3-yl)-N-(3-methylphenyl)oxamide.
| Compound Name | N'-[2-(dimethylamino)ethyl]-N'-(1,1-dioxothiolan-3-yl)-N-(3-methylphenyl)oxamide |
|---|---|
| PubChem CID | 108515684 |
| Molecular Formula | C17H25N3O4S |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | N'-[2-(dimethylamino)ethyl]-N'-(1,1-dioxothiolan-3-yl)-N-(3-methylphenyl)oxamide |
| SMILES | Cc1cccc(NC(=O)C(=O)N(CCN(C)C)C2CCS(=O)(=O)C2)c1 |
| InChI | InChI=1S/C17H25N3O4S/c1-13-5-4-6-14(11-13)18-16(21)17(22)20(9-8-19(2)3)15-7-10-25(23,24)12-15/h4-6,11,15H,7-10,12H2,1-3H3,(H,18,21) |
| InChIKey | IAOUOOGFHFJDMX-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|