C18H26ClN3O4S — CID 108527205
N-(2-chloro-4,6-dimethylphenyl)-N'-[2-(dimethylamino)ethyl]-N'-(1,1-dioxothiolan-3-yl)oxamide (PubChem CID 108527205) has the molecular formula C18H26ClN3O4S and a molecular weight of 415.94 g/mol. Its IUPAC name is N-(2-chloro-4,6-dimethylphenyl)-N'-[2-(dimethylamino)ethyl]-N'-(1,1-dioxothiolan-3-yl)oxamide.
| Compound Name | N-(2-chloro-4,6-dimethylphenyl)-N'-[2-(dimethylamino)ethyl]-N'-(1,1-dioxothiolan-3-yl)oxamide |
|---|---|
| PubChem CID | 108527205 |
| Molecular Formula | C18H26ClN3O4S |
| Molecular Weight | 415.94 g/mol |
| Exact Mass | 415.13 |
| IUPAC Name | N-(2-chloro-4,6-dimethylphenyl)-N'-[2-(dimethylamino)ethyl]-N'-(1,1-dioxothiolan-3-yl)oxamide |
| SMILES | Cc1cc(C)c(NC(=O)C(=O)N(CCN(C)C)C2CCS(=O)(=O)C2)c(Cl)c1 |
| InChI | InChI=1S/C18H26ClN3O4S/c1-12-9-13(2)16(15(19)10-12)20-17(23)18(24)22(7-6-21(3)4)14-5-8-27(25,26)11-14/h9-10,14H,5-8,11H2,1-4H3,(H,20,23) |
| InChIKey | FRMVAQWSWOIKHS-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.94 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|