C15H20ClN3O5S — CID 108516105
N-(4-amino-3-chlorophenyl)-N'-(1,1-dioxothiolan-3-yl)-N'-(2-methoxyethyl)oxamide (PubChem CID 108516105) has the molecular formula C15H20ClN3O5S and a molecular weight of 389.86 g/mol. Its IUPAC name is N-(4-amino-3-chlorophenyl)-N'-(1,1-dioxothiolan-3-yl)-N'-(2-methoxyethyl)oxamide.
| Compound Name | N-(4-amino-3-chlorophenyl)-N'-(1,1-dioxothiolan-3-yl)-N'-(2-methoxyethyl)oxamide |
|---|---|
| PubChem CID | 108516105 |
| Molecular Formula | C15H20ClN3O5S |
| Molecular Weight | 389.86 g/mol |
| Exact Mass | 389.08 |
| IUPAC Name | N-(4-amino-3-chlorophenyl)-N'-(1,1-dioxothiolan-3-yl)-N'-(2-methoxyethyl)oxamide |
| SMILES | COCCN(C(=O)C(=O)Nc1ccc(N)c(Cl)c1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C15H20ClN3O5S/c1-24-6-5-19(11-4-7-25(22,23)9-11)15(21)14(20)18-10-2-3-13(17)12(16)8-10/h2-3,8,11H,4-7,9,17H2,1H3,(H,18,20) |
| InChIKey | CPQBNWSCNKQYRY-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 118.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.86 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|