C15H20ClFN2O3S2 — CID 21008687
3-(3-chloro-4-fluorophenyl)-1-(1,1-dioxothiolan-3-yl)-1-(3-methoxypropyl)thiourea (PubChem CID 21008687) has the molecular formula C15H20ClFN2O3S2 and a molecular weight of 394.92 g/mol. Its IUPAC name is 3-(3-chloro-4-fluorophenyl)-1-(1,1-dioxothiolan-3-yl)-1-(3-methoxypropyl)thiourea.
| Compound Name | 3-(3-chloro-4-fluorophenyl)-1-(1,1-dioxothiolan-3-yl)-1-(3-methoxypropyl)thiourea |
|---|---|
| PubChem CID | 21008687 |
| Molecular Formula | C15H20ClFN2O3S2 |
| Molecular Weight | 394.92 g/mol |
| Exact Mass | 394.06 |
| IUPAC Name | 3-(3-chloro-4-fluorophenyl)-1-(1,1-dioxothiolan-3-yl)-1-(3-methoxypropyl)thiourea |
| SMILES | COCCCN(C(=S)Nc1ccc(F)c(Cl)c1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C15H20ClFN2O3S2/c1-22-7-2-6-19(12-5-8-24(20,21)10-12)15(23)18-11-3-4-14(17)13(16)9-11/h3-4,9,12H,2,5-8,10H2,1H3,(H,18,23) |
| InChIKey | PXBFXBDQKODTLH-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.92 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|