C17H26N2O2S2 — CID 8682291
1-butyl-3-(3,4-dimethylphenyl)-1-[(3S)-1,1-dioxothiolan-3-yl]thiourea (PubChem CID 8682291) has the molecular formula C17H26N2O2S2 and a molecular weight of 354.54 g/mol. Its IUPAC name is 1-butyl-3-(3,4-dimethylphenyl)-1-[(3S)-1,1-dioxothiolan-3-yl]thiourea.
| Compound Name | 1-butyl-3-(3,4-dimethylphenyl)-1-[(3S)-1,1-dioxothiolan-3-yl]thiourea |
|---|---|
| PubChem CID | 8682291 |
| Molecular Formula | C17H26N2O2S2 |
| Molecular Weight | 354.54 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | 1-butyl-3-(3,4-dimethylphenyl)-1-[(3S)-1,1-dioxothiolan-3-yl]thiourea |
| SMILES | CCCCN(C(=S)Nc1ccc(C)c(C)c1)[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C17H26N2O2S2/c1-4-5-9-19(16-8-10-23(20,21)12-16)17(22)18-15-7-6-13(2)14(3)11-15/h6-7,11,16H,4-5,8-10,12H2,1-3H3,(H,18,22)/t16-/m0/s1 |
| InChIKey | JROQMDKOQUTZQK-INIZCTEOSA-N |
| XLogP | 3.29 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.54 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|