C15H21N3O4S2 — CID 8682331
1-butyl-1-[(3R)-1,1-dioxothiolan-3-yl]-3-(4-nitrophenyl)thiourea (PubChem CID 8682331) has the molecular formula C15H21N3O4S2 and a molecular weight of 371.48 g/mol. Its IUPAC name is 1-butyl-1-[(3R)-1,1-dioxothiolan-3-yl]-3-(4-nitrophenyl)thiourea.
| Compound Name | 1-butyl-1-[(3R)-1,1-dioxothiolan-3-yl]-3-(4-nitrophenyl)thiourea |
|---|---|
| PubChem CID | 8682331 |
| Molecular Formula | C15H21N3O4S2 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.10 |
| IUPAC Name | 1-butyl-1-[(3R)-1,1-dioxothiolan-3-yl]-3-(4-nitrophenyl)thiourea |
| SMILES | CCCCN(C(=S)Nc1ccc([N+](=O)[O-])cc1)[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C15H21N3O4S2/c1-2-3-9-17(14-8-10-24(21,22)11-14)15(23)16-12-4-6-13(7-5-12)18(19)20/h4-7,14H,2-3,8-11H2,1H3,(H,16,23)/t14-/m1/s1 |
| InChIKey | FATLQXHTXZTOMW-CQSZACIVSA-N |
| XLogP | 2.58 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|