C16H24N2O2S2 — CID 8681124
1-[(3R)-1,1-dioxothiolan-3-yl]-1-ethyl-3-(4-propan-2-ylphenyl)thiourea (PubChem CID 8681124) has the molecular formula C16H24N2O2S2 and a molecular weight of 340.51 g/mol. Its IUPAC name is 1-[(3R)-1,1-dioxothiolan-3-yl]-1-ethyl-3-(4-propan-2-ylphenyl)thiourea.
| Compound Name | 1-[(3R)-1,1-dioxothiolan-3-yl]-1-ethyl-3-(4-propan-2-ylphenyl)thiourea |
|---|---|
| PubChem CID | 8681124 |
| Molecular Formula | C16H24N2O2S2 |
| Molecular Weight | 340.51 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | 1-[(3R)-1,1-dioxothiolan-3-yl]-1-ethyl-3-(4-propan-2-ylphenyl)thiourea |
| SMILES | CCN(C(=S)Nc1ccc(C(C)C)cc1)[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C16H24N2O2S2/c1-4-18(15-9-10-22(19,20)11-15)16(21)17-14-7-5-13(6-8-14)12(2)3/h5-8,12,15H,4,9-11H2,1-3H3,(H,17,21)/t15-/m1/s1 |
| InChIKey | QDJPHCPQOUXMMJ-OAHLLOKOSA-N |
| XLogP | 3.02 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.51 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|