C15H23N3O4S3 — CID 8681111
3-[3-(dimethylsulfamoyl)phenyl]-1-[(3S)-1,1-dioxothiolan-3-yl]-1-ethylthiourea (PubChem CID 8681111) has the molecular formula C15H23N3O4S3 and a molecular weight of 405.57 g/mol. Its IUPAC name is 3-[3-(dimethylsulfamoyl)phenyl]-1-[(3S)-1,1-dioxothiolan-3-yl]-1-ethylthiourea.
| Compound Name | 3-[3-(dimethylsulfamoyl)phenyl]-1-[(3S)-1,1-dioxothiolan-3-yl]-1-ethylthiourea |
|---|---|
| PubChem CID | 8681111 |
| Molecular Formula | C15H23N3O4S3 |
| Molecular Weight | 405.57 g/mol |
| Exact Mass | 405.09 |
| IUPAC Name | 3-[3-(dimethylsulfamoyl)phenyl]-1-[(3S)-1,1-dioxothiolan-3-yl]-1-ethylthiourea |
| SMILES | CCN(C(=S)Nc1cccc(S(=O)(=O)N(C)C)c1)[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C15H23N3O4S3/c1-4-18(13-8-9-24(19,20)11-13)15(23)16-12-6-5-7-14(10-12)25(21,22)17(2)3/h5-7,10,13H,4,8-9,11H2,1-3H3,(H,16,23)/t13-/m0/s1 |
| InChIKey | UOLRNRNQMOPXOE-ZDUSSCGKSA-N |
| XLogP | 1.14 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.57 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|