C13H18BrN3O2S2 — CID 9237569
3-(3-bromophenyl)-1-(dimethylamino)-1-[(3R)-1,1-dioxothiolan-3-yl]thiourea (PubChem CID 9237569) has the molecular formula C13H18BrN3O2S2 and a molecular weight of 392.34 g/mol. Its IUPAC name is 3-(3-bromophenyl)-1-(dimethylamino)-1-[(3R)-1,1-dioxothiolan-3-yl]thiourea.
| Compound Name | 3-(3-bromophenyl)-1-(dimethylamino)-1-[(3R)-1,1-dioxothiolan-3-yl]thiourea |
|---|---|
| PubChem CID | 9237569 |
| Molecular Formula | C13H18BrN3O2S2 |
| Molecular Weight | 392.34 g/mol |
| Exact Mass | 391.00 |
| IUPAC Name | 3-(3-bromophenyl)-1-(dimethylamino)-1-[(3R)-1,1-dioxothiolan-3-yl]thiourea |
| SMILES | CN(C)N(C(=S)Nc1cccc(Br)c1)[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H18BrN3O2S2/c1-16(2)17(12-6-7-21(18,19)9-12)13(20)15-11-5-3-4-10(14)8-11/h3-5,8,12H,6-7,9H2,1-2H3,(H,15,20)/t12-/m1/s1 |
| InChIKey | ZCSOEBHEVWOQGC-GFCCVEGCSA-N |
| XLogP | 2.11 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.34 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|