C14H21N3O3S2 — CID 8600073
1-(dimethylamino)-1-[(3R)-1,1-dioxothiolan-3-yl]-3-(3-methoxyphenyl)thiourea (PubChem CID 8600073) has the molecular formula C14H21N3O3S2 and a molecular weight of 343.47 g/mol. Its IUPAC name is 1-(dimethylamino)-1-[(3R)-1,1-dioxothiolan-3-yl]-3-(3-methoxyphenyl)thiourea.
| Compound Name | 1-(dimethylamino)-1-[(3R)-1,1-dioxothiolan-3-yl]-3-(3-methoxyphenyl)thiourea |
|---|---|
| PubChem CID | 8600073 |
| Molecular Formula | C14H21N3O3S2 |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | 1-(dimethylamino)-1-[(3R)-1,1-dioxothiolan-3-yl]-3-(3-methoxyphenyl)thiourea |
| SMILES | COc1cccc(NC(=S)N([C@@H]2CCS(=O)(=O)C2)N(C)C)c1 |
| InChI | InChI=1S/C14H21N3O3S2/c1-16(2)17(12-7-8-22(18,19)10-12)14(21)15-11-5-4-6-13(9-11)20-3/h4-6,9,12H,7-8,10H2,1-3H3,(H,15,21)/t12-/m1/s1 |
| InChIKey | IVQOYXRZTTWXIH-GFCCVEGCSA-N |
| XLogP | 1.36 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|