C14H21N3O2S2 — CID 8600062
1-(dimethylamino)-1-[(3R)-1,1-dioxothiolan-3-yl]-3-(2-methylphenyl)thiourea (PubChem CID 8600062) has the molecular formula C14H21N3O2S2 and a molecular weight of 327.48 g/mol. Its IUPAC name is 1-(dimethylamino)-1-[(3R)-1,1-dioxothiolan-3-yl]-3-(2-methylphenyl)thiourea.
| Compound Name | 1-(dimethylamino)-1-[(3R)-1,1-dioxothiolan-3-yl]-3-(2-methylphenyl)thiourea |
|---|---|
| PubChem CID | 8600062 |
| Molecular Formula | C14H21N3O2S2 |
| Molecular Weight | 327.48 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | 1-(dimethylamino)-1-[(3R)-1,1-dioxothiolan-3-yl]-3-(2-methylphenyl)thiourea |
| SMILES | Cc1ccccc1NC(=S)N([C@@H]1CCS(=O)(=O)C1)N(C)C |
| InChI | InChI=1S/C14H21N3O2S2/c1-11-6-4-5-7-13(11)15-14(20)17(16(2)3)12-8-9-21(18,19)10-12/h4-7,12H,8-10H2,1-3H3,(H,15,20)/t12-/m1/s1 |
| InChIKey | RCUXYONBKILUGX-GFCCVEGCSA-N |
| XLogP | 1.66 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.48 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|