C13H17ClN2O2S2 — CID 9053108
3-(3-chloro-2-methylphenyl)-1-[(3S)-1,1-dioxothiolan-3-yl]-1-methylthiourea (PubChem CID 9053108) has the molecular formula C13H17ClN2O2S2 and a molecular weight of 332.88 g/mol. Its IUPAC name is 3-(3-chloro-2-methylphenyl)-1-[(3S)-1,1-dioxothiolan-3-yl]-1-methylthiourea.
| Compound Name | 3-(3-chloro-2-methylphenyl)-1-[(3S)-1,1-dioxothiolan-3-yl]-1-methylthiourea |
|---|---|
| PubChem CID | 9053108 |
| Molecular Formula | C13H17ClN2O2S2 |
| Molecular Weight | 332.88 g/mol |
| Exact Mass | 332.04 |
| IUPAC Name | 3-(3-chloro-2-methylphenyl)-1-[(3S)-1,1-dioxothiolan-3-yl]-1-methylthiourea |
| SMILES | Cc1c(Cl)cccc1NC(=S)N(C)[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H17ClN2O2S2/c1-9-11(14)4-3-5-12(9)15-13(19)16(2)10-6-7-20(17,18)8-10/h3-5,10H,6-8H2,1-2H3,(H,15,19)/t10-/m0/s1 |
| InChIKey | JATJRLPDFUAOJH-JTQLQIEISA-N |
| XLogP | 2.46 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.88 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|