C16H23ClN3O2S2+ — CID 9284197
N-(3-chloro-2-methylphenyl)-4-[(3R)-1,1-dioxothiolan-3-yl]piperazin-4-ium-1-carbothioamide (PubChem CID 9284197) has the molecular formula C16H23ClN3O2S2+ and a molecular weight of 388.97 g/mol. Its IUPAC name is N-(3-chloro-2-methylphenyl)-4-[(3R)-1,1-dioxothiolan-3-yl]piperazin-4-ium-1-carbothioamide.
| Compound Name | N-(3-chloro-2-methylphenyl)-4-[(3R)-1,1-dioxothiolan-3-yl]piperazin-4-ium-1-carbothioamide |
|---|---|
| PubChem CID | 9284197 |
| Molecular Formula | C16H23ClN3O2S2+ |
| Molecular Weight | 388.97 g/mol |
| Exact Mass | 388.09 |
| IUPAC Name | N-(3-chloro-2-methylphenyl)-4-[(3R)-1,1-dioxothiolan-3-yl]piperazin-4-ium-1-carbothioamide |
| SMILES | Cc1c(Cl)cccc1NC(=S)N1CC[NH+]([C@@H]2CCS(=O)(=O)C2)CC1 |
| InChI | InChI=1S/C16H22ClN3O2S2/c1-12-14(17)3-2-4-15(12)18-16(23)20-8-6-19(7-9-20)13-5-10-24(21,22)11-13/h2-4,13H,5-11H2,1H3,(H,18,23)/p+1/t13-/m1/s1 |
| InChIKey | HRUCGCDXCWCNTC-CYBMUJFWSA-O |
| XLogP | 0.73 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.97 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|