C16H24N3O2S2+ — CID 9284163
N-benzyl-4-[(3S)-1,1-dioxothiolan-3-yl]piperazin-4-ium-1-carbothioamide (PubChem CID 9284163) has the molecular formula C16H24N3O2S2+ and a molecular weight of 354.52 g/mol. Its IUPAC name is N-benzyl-4-[(3S)-1,1-dioxothiolan-3-yl]piperazin-4-ium-1-carbothioamide.
| Compound Name | N-benzyl-4-[(3S)-1,1-dioxothiolan-3-yl]piperazin-4-ium-1-carbothioamide |
|---|---|
| PubChem CID | 9284163 |
| Molecular Formula | C16H24N3O2S2+ |
| Molecular Weight | 354.52 g/mol |
| Exact Mass | 354.13 |
| IUPAC Name | N-benzyl-4-[(3S)-1,1-dioxothiolan-3-yl]piperazin-4-ium-1-carbothioamide |
| SMILES | O=S1(=O)CC[C@H]([NH+]2CCN(C(=S)NCc3ccccc3)CC2)C1 |
| InChI | InChI=1S/C16H23N3O2S2/c20-23(21)11-6-15(13-23)18-7-9-19(10-8-18)16(22)17-12-14-4-2-1-3-5-14/h1-5,15H,6-13H2,(H,17,22)/p+1/t15-/m0/s1 |
| InChIKey | SQDDOJHPVZLUJZ-HNNXBMFYSA-O |
| XLogP | -0.55 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.52 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|