C16H20N4S — CID 10685638
N-benzyl-4-(1H-imidazol-5-yl)piperidine-1-carbothioamide (PubChem CID 10685638) has the molecular formula C16H20N4S and a molecular weight of 300.43 g/mol. Its IUPAC name is N-benzyl-4-(1H-imidazol-5-yl)piperidine-1-carbothioamide.
| Compound Name | N-benzyl-4-(1H-imidazol-5-yl)piperidine-1-carbothioamide |
|---|---|
| PubChem CID | 10685638 |
| Molecular Formula | C16H20N4S |
| Molecular Weight | 300.43 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | N-benzyl-4-(1H-imidazol-5-yl)piperidine-1-carbothioamide |
| SMILES | S=C(NCc1ccccc1)N1CCC(c2cnc[nH]2)CC1 |
| InChI | InChI=1S/C16H20N4S/c21-16(18-10-13-4-2-1-3-5-13)20-8-6-14(7-9-20)15-11-17-12-19-15/h1-5,11-12,14H,6-10H2,(H,17,19)(H,18,21) |
| InChIKey | LXIIQVGCDOSCGF-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 43.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.43 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|