C21H26N4S2 — CID 27235619
(2S)-1-N,4-N-dibenzyl-2-methylpiperazine-1,4-dicarbothioamide (PubChem CID 27235619) has the molecular formula C21H26N4S2 and a molecular weight of 398.60 g/mol. Its IUPAC name is (2S)-1-N,4-N-dibenzyl-2-methylpiperazine-1,4-dicarbothioamide.
| Compound Name | (2S)-1-N,4-N-dibenzyl-2-methylpiperazine-1,4-dicarbothioamide |
|---|---|
| PubChem CID | 27235619 |
| Molecular Formula | C21H26N4S2 |
| Molecular Weight | 398.60 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | (2S)-1-N,4-N-dibenzyl-2-methylpiperazine-1,4-dicarbothioamide |
| SMILES | C[C@H]1CN(C(=S)NCc2ccccc2)CCN1C(=S)NCc1ccccc1 |
| InChI | InChI=1S/C21H26N4S2/c1-17-16-24(20(26)22-14-18-8-4-2-5-9-18)12-13-25(17)21(27)23-15-19-10-6-3-7-11-19/h2-11,17H,12-16H2,1H3,(H,22,26)(H,23,27)/t17-/m0/s1 |
| InChIKey | CWMMXWSMKXGCKL-KRWDZBQOSA-N |
| XLogP | 3.14 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.60 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|