C15H26N4S2 — CID 20788464
2-methyl-1-N,4-N-bis(2-methylprop-2-enyl)piperazine-1,4-dicarbothioamide (PubChem CID 20788464) has the molecular formula C15H26N4S2 and a molecular weight of 326.54 g/mol. Its IUPAC name is 2-methyl-1-N,4-N-bis(2-methylprop-2-enyl)piperazine-1,4-dicarbothioamide.
| Compound Name | 2-methyl-1-N,4-N-bis(2-methylprop-2-enyl)piperazine-1,4-dicarbothioamide |
|---|---|
| PubChem CID | 20788464 |
| Molecular Formula | C15H26N4S2 |
| Molecular Weight | 326.54 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | 2-methyl-1-N,4-N-bis(2-methylprop-2-enyl)piperazine-1,4-dicarbothioamide |
| SMILES | C=C(C)CNC(=S)N1CCN(C(=S)NCC(=C)C)C(C)C1 |
| InChI | InChI=1S/C15H26N4S2/c1-11(2)8-16-14(20)18-6-7-19(13(5)10-18)15(21)17-9-12(3)4/h13H,1,3,6-10H2,2,4-5H3,(H,16,20)(H,17,21) |
| InChIKey | ZOKVLELDWWIIBV-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.54 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|