C15H26N2S — CID 98157710
(1R,5R)-1,3,3-trimethyl-N-(2-methylprop-2-enyl)-6-azabicyclo[3.2.1]octane-6-carbothioamide (PubChem CID 98157710) has the molecular formula C15H26N2S and a molecular weight of 266.45 g/mol. Its IUPAC name is (1R,5R)-1,3,3-trimethyl-N-(2-methylprop-2-enyl)-6-azabicyclo[3.2.1]octane-6-carbothioamide.
| Compound Name | (1R,5R)-1,3,3-trimethyl-N-(2-methylprop-2-enyl)-6-azabicyclo[3.2.1]octane-6-carbothioamide |
|---|---|
| PubChem CID | 98157710 |
| Molecular Formula | C15H26N2S |
| Molecular Weight | 266.45 g/mol |
| Exact Mass | 266.18 |
| IUPAC Name | (1R,5R)-1,3,3-trimethyl-N-(2-methylprop-2-enyl)-6-azabicyclo[3.2.1]octane-6-carbothioamide |
| SMILES | C=C(C)CNC(=S)N1C[C@@]2(C)C[C@H]1CC(C)(C)C2 |
| InChI | InChI=1S/C15H26N2S/c1-11(2)8-16-13(18)17-10-15(5)7-12(17)6-14(3,4)9-15/h12H,1,6-10H2,2-5H3,(H,16,18)/t12-,15+/m1/s1 |
| InChIKey | DATPVEKOFAVZNL-DOMZBBRYSA-N |
| XLogP | 3.34 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.45 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|