1,3,3-trimethyl-6-azabicyclo[3.2.1]octane-6-carbonyl chloride

C11H18ClNO — CID 54116057

IUPAC1,3,3-trimethyl-6-azabicyclo[3.2.1]octane-6-carbonyl chloride
SMILESCC1(C)CC2CC(C)(CN2C(=O)Cl)C1
InChIInChI=1S/C11H18ClNO/c1-10(2)4-8-5-11(3,6-10)7-13(8)9(12)14/h8H,4-7H2,1-3H3
InChIKeyNKKVBKCOZLTBLI-UHFFFAOYSA-N
MW215.72 g/mol
LogP3.25
Rot. Bonds

About 1,3,3-trimethyl-6-azabicyclo[3.2.1]octane-6-carbonyl chloride

1,3,3-trimethyl-6-azabicyclo[3.2.1]octane-6-carbonyl chloride (PubChem CID 54116057) has the molecular formula C11H18ClNO and a molecular weight of 215.72 g/mol. Its IUPAC name is 1,3,3-trimethyl-6-azabicyclo[3.2.1]octane-6-carbonyl chloride.

Molecular Properties

Compound Name1,3,3-trimethyl-6-azabicyclo[3.2.1]octane-6-carbonyl chloride
PubChem CID54116057
Molecular FormulaC11H18ClNO
Molecular Weight215.72 g/mol
Exact Mass215.11
IUPAC Name1,3,3-trimethyl-6-azabicyclo[3.2.1]octane-6-carbonyl chloride
SMILESCC1(C)CC2CC(C)(CN2C(=O)Cl)C1
InChIInChI=1S/C11H18ClNO/c1-10(2)4-8-5-11(3,6-10)7-13(8)9(12)14/h8H,4-7H2,1-3H3
InChIKeyNKKVBKCOZLTBLI-UHFFFAOYSA-N
XLogP3.25
TPSA20.31 Ų
H-Bond Donors
H-Bond Acceptors1
Rotatable Bonds
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500215.72
LogP ≤ 53.25
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}

Analyze 1,3,3-trimethyl-6-azabicyclo[3.2.1]octane-6-carbonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1,3,3-trimethyl-6-azabicyclo[3.2.1]octane-6-carbonyl chloride?
The IUPAC name of 1,3,3-trimethyl-6-azabicyclo[3.2.1]octane-6-carbonyl chloride (CID 54116057) is 1,3,3-trimethyl-6-azabicyclo[3.2.1]octane-6-carbonyl chloride.
What is the SMILES notation for 1,3,3-trimethyl-6-azabicyclo[3.2.1]octane-6-carbonyl chloride?
The canonical SMILES for 1,3,3-trimethyl-6-azabicyclo[3.2.1]octane-6-carbonyl chloride is CC1(C)CC2CC(C)(CN2C(=O)Cl)C1.
What is the InChIKey of 1,3,3-trimethyl-6-azabicyclo[3.2.1]octane-6-carbonyl chloride?
The InChIKey is NKKVBKCOZLTBLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18ClNO/c1-10(2)4-8-5-11(3,6-10)7-13(8)9(12)14/h8H,4-7H2,1-3H3.
What are the key properties of 1,3,3-trimethyl-6-azabicyclo[3.2.1]octane-6-carbonyl chloride?
1,3,3-trimethyl-6-azabicyclo[3.2.1]octane-6-carbonyl chloride has a molecular weight of 215.72 g/mol, XLogP of 3.25, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3,3-trimethyl-6-azabicyclo[3.2.1]octane-6-carbonyl chloride is sourced from PubChem (CID 54116057), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).