C11H18ClNO — CID 54116057
1,3,3-trimethyl-6-azabicyclo[3.2.1]octane-6-carbonyl chloride (PubChem CID 54116057) has the molecular formula C11H18ClNO and a molecular weight of 215.72 g/mol. Its IUPAC name is 1,3,3-trimethyl-6-azabicyclo[3.2.1]octane-6-carbonyl chloride.
| Compound Name | 1,3,3-trimethyl-6-azabicyclo[3.2.1]octane-6-carbonyl chloride |
|---|---|
| PubChem CID | 54116057 |
| Molecular Formula | C11H18ClNO |
| Molecular Weight | 215.72 g/mol |
| Exact Mass | 215.11 |
| IUPAC Name | 1,3,3-trimethyl-6-azabicyclo[3.2.1]octane-6-carbonyl chloride |
| SMILES | CC1(C)CC2CC(C)(CN2C(=O)Cl)C1 |
| InChI | InChI=1S/C11H18ClNO/c1-10(2)4-8-5-11(3,6-10)7-13(8)9(12)14/h8H,4-7H2,1-3H3 |
| InChIKey | NKKVBKCOZLTBLI-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.72 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|