C28H42N4O2 — CID 98089225
(1S,5S)-1,3,3-trimethyl-N-[4-[[(1R,5S)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octane-6-carbonyl]amino]phenyl]-6-azabicyclo[3.2.1]octane-6-carboxamide (PubChem CID 98089225) has the molecular formula C28H42N4O2 and a molecular weight of 466.67 g/mol. Its IUPAC name is (1S,5S)-1,3,3-trimethyl-N-[4-[[(1R,5S)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octane-6-carbonyl]amino]phenyl]-6-azabicyclo[3.2.1]octane-6-carboxamide.
| Compound Name | (1S,5S)-1,3,3-trimethyl-N-[4-[[(1R,5S)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octane-6-carbonyl]amino]phenyl]-6-azabicyclo[3.2.1]octane-6-carboxamide |
|---|---|
| PubChem CID | 98089225 |
| Molecular Formula | C28H42N4O2 |
| Molecular Weight | 466.67 g/mol |
| Exact Mass | 466.33 |
| IUPAC Name | (1S,5S)-1,3,3-trimethyl-N-[4-[[(1R,5S)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octane-6-carbonyl]amino]phenyl]-6-azabicyclo[3.2.1]octane-6-carboxamide |
| SMILES | CC1(C)C[C@H]2C[C@@](C)(CN2C(=O)Nc2ccc(NC(=O)N3C[C@@]4(C)C[C@@H]3CC(C)(C)C4)cc2)C1 |
| InChI | InChI=1S/C28H42N4O2/c1-25(2)11-21-13-27(5,15-25)17-31(21)23(33)29-19-7-9-20(10-8-19)30-24(34)32-18-28(6)14-22(32)12-26(3,4)16-28/h7-10,21-22H,11-18H2,1-6H3,(H,29,33)(H,30,34)/t21-,22-,27-,28+/m0/s1 |
| InChIKey | GYERAPHNMJDEPR-TVCBXBRYSA-N |
| XLogP | 6.55 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.67 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |