C19H28N2S — CID 5238733
N-(4-ethylphenyl)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octane-6-carbothioamide (PubChem CID 5238733) has the molecular formula C19H28N2S and a molecular weight of 316.51 g/mol. Its IUPAC name is N-(4-ethylphenyl)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octane-6-carbothioamide.
| Compound Name | N-(4-ethylphenyl)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octane-6-carbothioamide |
|---|---|
| PubChem CID | 5238733 |
| Molecular Formula | C19H28N2S |
| Molecular Weight | 316.51 g/mol |
| Exact Mass | 316.20 |
| IUPAC Name | N-(4-ethylphenyl)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octane-6-carbothioamide |
| SMILES | CCc1ccc(NC(=S)N2CC3(C)CC2CC(C)(C)C3)cc1 |
| InChI | InChI=1S/C19H28N2S/c1-5-14-6-8-15(9-7-14)20-17(22)21-13-19(4)11-16(21)10-18(2,3)12-19/h6-9,16H,5,10-13H2,1-4H3,(H,20,22) |
| InChIKey | GZDJXDBTRKVIGE-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.51 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|