C19H28N2S — CID 7733576
(1S,5S)-N-(2,6-dimethylphenyl)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octane-6-carbothioamide (PubChem CID 7733576) has the molecular formula C19H28N2S and a molecular weight of 316.51 g/mol. Its IUPAC name is (1S,5S)-N-(2,6-dimethylphenyl)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octane-6-carbothioamide.
| Compound Name | (1S,5S)-N-(2,6-dimethylphenyl)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octane-6-carbothioamide |
|---|---|
| PubChem CID | 7733576 |
| Molecular Formula | C19H28N2S |
| Molecular Weight | 316.51 g/mol |
| Exact Mass | 316.20 |
| IUPAC Name | (1S,5S)-N-(2,6-dimethylphenyl)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octane-6-carbothioamide |
| SMILES | Cc1cccc(C)c1NC(=S)N1C[C@]2(C)C[C@@H]1CC(C)(C)C2 |
| InChI | InChI=1S/C19H28N2S/c1-13-7-6-8-14(2)16(13)20-17(22)21-12-19(5)10-15(21)9-18(3,4)11-19/h6-8,15H,9-12H2,1-5H3,(H,20,22)/t15-,19+/m0/s1 |
| InChIKey | FCQIESAORHSAGQ-HNAYVOBHSA-N |
| XLogP | 4.90 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.51 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|