C16H24N2S — CID 7765195
(3S,5S)-N-(2,6-dimethylphenyl)-3,5-dimethylpiperidine-1-carbothioamide (PubChem CID 7765195) has the molecular formula C16H24N2S and a molecular weight of 276.45 g/mol. Its IUPAC name is (3S,5S)-N-(2,6-dimethylphenyl)-3,5-dimethylpiperidine-1-carbothioamide.
| Compound Name | (3S,5S)-N-(2,6-dimethylphenyl)-3,5-dimethylpiperidine-1-carbothioamide |
|---|---|
| PubChem CID | 7765195 |
| Molecular Formula | C16H24N2S |
| Molecular Weight | 276.45 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | (3S,5S)-N-(2,6-dimethylphenyl)-3,5-dimethylpiperidine-1-carbothioamide |
| SMILES | Cc1cccc(C)c1NC(=S)N1C[C@@H](C)C[C@H](C)C1 |
| InChI | InChI=1S/C16H24N2S/c1-11-8-12(2)10-18(9-11)16(19)17-15-13(3)6-5-7-14(15)4/h5-7,11-12H,8-10H2,1-4H3,(H,17,19)/t11-,12-/m0/s1 |
| InChIKey | DSNIDPHHWIMMTM-RYUDHWBXSA-N |
| XLogP | 3.98 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.45 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|