C20H31N3S — CID 4119386
4-[cyclopentyl(methyl)amino]-N-(2,6-dimethylphenyl)piperidine-1-carbothioamide (PubChem CID 4119386) has the molecular formula C20H31N3S and a molecular weight of 345.56 g/mol. Its IUPAC name is 4-[cyclopentyl(methyl)amino]-N-(2,6-dimethylphenyl)piperidine-1-carbothioamide.
| Compound Name | 4-[cyclopentyl(methyl)amino]-N-(2,6-dimethylphenyl)piperidine-1-carbothioamide |
|---|---|
| PubChem CID | 4119386 |
| Molecular Formula | C20H31N3S |
| Molecular Weight | 345.56 g/mol |
| Exact Mass | 345.22 |
| IUPAC Name | 4-[cyclopentyl(methyl)amino]-N-(2,6-dimethylphenyl)piperidine-1-carbothioamide |
| SMILES | Cc1cccc(C)c1NC(=S)N1CCC(N(C)C2CCCC2)CC1 |
| InChI | InChI=1S/C20H31N3S/c1-15-7-6-8-16(2)19(15)21-20(24)23-13-11-18(12-14-23)22(3)17-9-4-5-10-17/h6-8,17-18H,4-5,9-14H2,1-3H3,(H,21,24) |
| InChIKey | HCHUIMRNZABTAI-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.56 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|