C15H21N3OS — CID 23962507
4-acetyl-N-(2,6-dimethylphenyl)piperazine-1-carbothioamide (PubChem CID 23962507) has the molecular formula C15H21N3OS and a molecular weight of 291.42 g/mol. Its IUPAC name is 4-acetyl-N-(2,6-dimethylphenyl)piperazine-1-carbothioamide.
| Compound Name | 4-acetyl-N-(2,6-dimethylphenyl)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 23962507 |
| Molecular Formula | C15H21N3OS |
| Molecular Weight | 291.42 g/mol |
| Exact Mass | 291.14 |
| IUPAC Name | 4-acetyl-N-(2,6-dimethylphenyl)piperazine-1-carbothioamide |
| SMILES | CC(=O)N1CCN(C(=S)Nc2c(C)cccc2C)CC1 |
| InChI | InChI=1S/C15H21N3OS/c1-11-5-4-6-12(2)14(11)16-15(20)18-9-7-17(8-10-18)13(3)19/h4-6H,7-10H2,1-3H3,(H,16,20) |
| InChIKey | BBCLVZUBWWFCLT-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.42 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|