C19H20F3N3O2S2 — CID 55353418
N-(2,6-dimethylphenyl)-4-(2,3,4-trifluorophenyl)sulfonylpiperazine-1-carbothioamide (PubChem CID 55353418) has the molecular formula C19H20F3N3O2S2 and a molecular weight of 443.52 g/mol. Its IUPAC name is N-(2,6-dimethylphenyl)-4-(2,3,4-trifluorophenyl)sulfonylpiperazine-1-carbothioamide.
| Compound Name | N-(2,6-dimethylphenyl)-4-(2,3,4-trifluorophenyl)sulfonylpiperazine-1-carbothioamide |
|---|---|
| PubChem CID | 55353418 |
| Molecular Formula | C19H20F3N3O2S2 |
| Molecular Weight | 443.52 g/mol |
| Exact Mass | 443.09 |
| IUPAC Name | N-(2,6-dimethylphenyl)-4-(2,3,4-trifluorophenyl)sulfonylpiperazine-1-carbothioamide |
| SMILES | Cc1cccc(C)c1NC(=S)N1CCN(S(=O)(=O)c2ccc(F)c(F)c2F)CC1 |
| InChI | InChI=1S/C19H20F3N3O2S2/c1-12-4-3-5-13(2)18(12)23-19(28)24-8-10-25(11-9-24)29(26,27)15-7-6-14(20)16(21)17(15)22/h3-7H,8-11H2,1-2H3,(H,23,28) |
| InChIKey | ZLIHVBPOYCXOFI-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.52 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|