C18H22F3N3O2S2 — CID 50904952
N-[(1S,2R,4R)-2-bicyclo[2.2.1]heptanyl]-4-(2,3,4-trifluorophenyl)sulfonylpiperazine-1-carbothioamide (PubChem CID 50904952) has the molecular formula C18H22F3N3O2S2 and a molecular weight of 433.52 g/mol. Its IUPAC name is N-[(1S,2R,4R)-2-bicyclo[2.2.1]heptanyl]-4-(2,3,4-trifluorophenyl)sulfonylpiperazine-1-carbothioamide.
| Compound Name | N-[(1S,2R,4R)-2-bicyclo[2.2.1]heptanyl]-4-(2,3,4-trifluorophenyl)sulfonylpiperazine-1-carbothioamide |
|---|---|
| PubChem CID | 50904952 |
| Molecular Formula | C18H22F3N3O2S2 |
| Molecular Weight | 433.52 g/mol |
| Exact Mass | 433.11 |
| IUPAC Name | N-[(1S,2R,4R)-2-bicyclo[2.2.1]heptanyl]-4-(2,3,4-trifluorophenyl)sulfonylpiperazine-1-carbothioamide |
| SMILES | O=S(=O)(c1ccc(F)c(F)c1F)N1CCN(C(=S)N[C@@H]2C[C@@H]3CC[C@H]2C3)CC1 |
| InChI | InChI=1S/C18H22F3N3O2S2/c19-13-3-4-15(17(21)16(13)20)28(25,26)24-7-5-23(6-8-24)18(27)22-14-10-11-1-2-12(14)9-11/h3-4,11-12,14H,1-2,5-10H2,(H,22,27)/t11-,12+,14-/m1/s1 |
| InChIKey | GUDUKRWFEBJWIE-MBNYWOFBSA-N |
| XLogP | 2.47 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.52 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|