C19H27N3S — CID 11936690
4-benzyl-N-[(1R,2S,4S)-2-bicyclo[2.2.1]heptanyl]piperazine-1-carbothioamide (PubChem CID 11936690) has the molecular formula C19H27N3S and a molecular weight of 329.51 g/mol. Its IUPAC name is 4-benzyl-N-[(1R,2S,4S)-2-bicyclo[2.2.1]heptanyl]piperazine-1-carbothioamide.
| Compound Name | 4-benzyl-N-[(1R,2S,4S)-2-bicyclo[2.2.1]heptanyl]piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 11936690 |
| Molecular Formula | C19H27N3S |
| Molecular Weight | 329.51 g/mol |
| Exact Mass | 329.19 |
| IUPAC Name | 4-benzyl-N-[(1R,2S,4S)-2-bicyclo[2.2.1]heptanyl]piperazine-1-carbothioamide |
| SMILES | S=C(N[C@H]1C[C@H]2CC[C@@H]1C2)N1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C19H27N3S/c23-19(20-18-13-16-6-7-17(18)12-16)22-10-8-21(9-11-22)14-15-4-2-1-3-5-15/h1-5,16-18H,6-14H2,(H,20,23)/t16-,17+,18-/m0/s1 |
| InChIKey | OLJIXRUQZWVEGB-KSZLIROESA-N |
| XLogP | 2.87 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.51 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|