C19H25N3OS — CID 18557202
4-benzoyl-N-[(1R,2S,4R)-2-bicyclo[2.2.1]heptanyl]piperazine-1-carbothioamide (PubChem CID 18557202) has the molecular formula C19H25N3OS and a molecular weight of 343.50 g/mol. Its IUPAC name is 4-benzoyl-N-[(1R,2S,4R)-2-bicyclo[2.2.1]heptanyl]piperazine-1-carbothioamide.
| Compound Name | 4-benzoyl-N-[(1R,2S,4R)-2-bicyclo[2.2.1]heptanyl]piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 18557202 |
| Molecular Formula | C19H25N3OS |
| Molecular Weight | 343.50 g/mol |
| Exact Mass | 343.17 |
| IUPAC Name | 4-benzoyl-N-[(1R,2S,4R)-2-bicyclo[2.2.1]heptanyl]piperazine-1-carbothioamide |
| SMILES | O=C(c1ccccc1)N1CCN(C(=S)N[C@H]2C[C@@H]3CC[C@@H]2C3)CC1 |
| InChI | InChI=1S/C19H25N3OS/c23-18(15-4-2-1-3-5-15)21-8-10-22(11-9-21)19(24)20-17-13-14-6-7-16(17)12-14/h1-5,14,16-17H,6-13H2,(H,20,24)/t14-,16-,17+/m1/s1 |
| InChIKey | HKKCRBAOVRWJPP-OIISXLGYSA-N |
| XLogP | 2.51 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.50 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|