C14H17NO — CID 6980977
N-[(1R,2S,4R)-2-bicyclo[2.2.1]heptanyl]benzamide (PubChem CID 6980977) has the molecular formula C14H17NO and a molecular weight of 215.30 g/mol. Its IUPAC name is N-[(1R,2S,4R)-2-bicyclo[2.2.1]heptanyl]benzamide.
| Compound Name | N-[(1R,2S,4R)-2-bicyclo[2.2.1]heptanyl]benzamide |
|---|---|
| PubChem CID | 6980977 |
| Molecular Formula | C14H17NO |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.13 |
| IUPAC Name | N-[(1R,2S,4R)-2-bicyclo[2.2.1]heptanyl]benzamide |
| SMILES | O=C(N[C@H]1C[C@@H]2CC[C@@H]1C2)c1ccccc1 |
| InChI | InChI=1S/C14H17NO/c16-14(11-4-2-1-3-5-11)15-13-9-10-6-7-12(13)8-10/h1-5,10,12-13H,6-9H2,(H,15,16)/t10-,12-,13+/m1/s1 |
| InChIKey | OMKJOVVKLPKENU-RTXFEEFZSA-N |
| XLogP | 2.61 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |