C21H23NOS — CID 958858
N-[(1R,2S,4S)-2-bicyclo[2.2.1]heptanyl]-4-(phenylsulfanylmethyl)benzamide (PubChem CID 958858) has the molecular formula C21H23NOS and a molecular weight of 337.49 g/mol. Its IUPAC name is N-[(1R,2S,4S)-2-bicyclo[2.2.1]heptanyl]-4-(phenylsulfanylmethyl)benzamide.
| Compound Name | N-[(1R,2S,4S)-2-bicyclo[2.2.1]heptanyl]-4-(phenylsulfanylmethyl)benzamide |
|---|---|
| PubChem CID | 958858 |
| Molecular Formula | C21H23NOS |
| Molecular Weight | 337.49 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | N-[(1R,2S,4S)-2-bicyclo[2.2.1]heptanyl]-4-(phenylsulfanylmethyl)benzamide |
| SMILES | O=C(N[C@H]1C[C@H]2CC[C@@H]1C2)c1ccc(CSc2ccccc2)cc1 |
| InChI | InChI=1S/C21H23NOS/c23-21(22-20-13-16-8-11-18(20)12-16)17-9-6-15(7-10-17)14-24-19-4-2-1-3-5-19/h1-7,9-10,16,18,20H,8,11-14H2,(H,22,23)/t16-,18+,20-/m0/s1 |
| InChIKey | RQTSUNXDAHITAQ-HQRMLTQVSA-N |
| XLogP | 4.90 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.49 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |