C15H19NOS — CID 18555874
N-[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]-2-phenylsulfanylacetamide (PubChem CID 18555874) has the molecular formula C15H19NOS and a molecular weight of 261.39 g/mol. Its IUPAC name is N-[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]-2-phenylsulfanylacetamide.
| Compound Name | N-[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]-2-phenylsulfanylacetamide |
|---|---|
| PubChem CID | 18555874 |
| Molecular Formula | C15H19NOS |
| Molecular Weight | 261.39 g/mol |
| Exact Mass | 261.12 |
| IUPAC Name | N-[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]-2-phenylsulfanylacetamide |
| SMILES | O=C(CSc1ccccc1)N[C@@H]1C[C@@H]2CC[C@@H]1C2 |
| InChI | InChI=1S/C15H19NOS/c17-15(10-18-13-4-2-1-3-5-13)16-14-9-11-6-7-12(14)8-11/h1-5,11-12,14H,6-10H2,(H,16,17)/t11-,12-,14-/m1/s1 |
| InChIKey | BABOLYHWOYNOEE-YRGRVCCFSA-N |
| XLogP | 3.08 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.39 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |