C16H21NOS — CID 2899831
N-(2-bicyclo[2.2.1]heptanyl)-3-phenylsulfanylpropanamide (PubChem CID 2899831) has the molecular formula C16H21NOS and a molecular weight of 275.42 g/mol. Its IUPAC name is N-(2-bicyclo[2.2.1]heptanyl)-3-phenylsulfanylpropanamide.
| Compound Name | N-(2-bicyclo[2.2.1]heptanyl)-3-phenylsulfanylpropanamide |
|---|---|
| PubChem CID | 2899831 |
| Molecular Formula | C16H21NOS |
| Molecular Weight | 275.42 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | N-(2-bicyclo[2.2.1]heptanyl)-3-phenylsulfanylpropanamide |
| SMILES | O=C(CCSc1ccccc1)NC1CC2CCC1C2 |
| InChI | InChI=1S/C16H21NOS/c18-16(8-9-19-14-4-2-1-3-5-14)17-15-11-12-6-7-13(15)10-12/h1-5,12-13,15H,6-11H2,(H,17,18) |
| InChIKey | KBGVBELNPALBJS-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.42 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |