C21H24N2O3S — CID 23229827
4-[benzenesulfonyl(methyl)amino]-N-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]benzamide (PubChem CID 23229827) has the molecular formula C21H24N2O3S and a molecular weight of 384.50 g/mol. Its IUPAC name is 4-[benzenesulfonyl(methyl)amino]-N-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]benzamide.
| Compound Name | 4-[benzenesulfonyl(methyl)amino]-N-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]benzamide |
|---|---|
| PubChem CID | 23229827 |
| Molecular Formula | C21H24N2O3S |
| Molecular Weight | 384.50 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | 4-[benzenesulfonyl(methyl)amino]-N-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]benzamide |
| SMILES | CN(c1ccc(C(=O)N[C@H]2C[C@H]3CC[C@H]2C3)cc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C21H24N2O3S/c1-23(27(25,26)19-5-3-2-4-6-19)18-11-9-16(10-12-18)21(24)22-20-14-15-7-8-17(20)13-15/h2-6,9-12,15,17,20H,7-8,13-14H2,1H3,(H,22,24)/t15-,17-,20-/m0/s1 |
| InChIKey | RNCKYSFCIBTSQO-KNBMTAEXSA-N |
| XLogP | 3.43 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.50 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |