C23H26N2O3S — CID 133145390
4-[benzenesulfonyl(prop-2-enyl)amino]-N-[(2R)-2-bicyclo[2.2.1]heptanyl]benzamide (PubChem CID 133145390) has the molecular formula C23H26N2O3S and a molecular weight of 410.54 g/mol. Its IUPAC name is 4-[benzenesulfonyl(prop-2-enyl)amino]-N-[(2R)-2-bicyclo[2.2.1]heptanyl]benzamide.
| Compound Name | 4-[benzenesulfonyl(prop-2-enyl)amino]-N-[(2R)-2-bicyclo[2.2.1]heptanyl]benzamide |
|---|---|
| PubChem CID | 133145390 |
| Molecular Formula | C23H26N2O3S |
| Molecular Weight | 410.54 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | 4-[benzenesulfonyl(prop-2-enyl)amino]-N-[(2R)-2-bicyclo[2.2.1]heptanyl]benzamide |
| SMILES | C=CCN(c1ccc(C(=O)N[C@@H]2CC3CCC2C3)cc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C23H26N2O3S/c1-2-14-25(29(27,28)21-6-4-3-5-7-21)20-12-10-18(11-13-20)23(26)24-22-16-17-8-9-19(22)15-17/h2-7,10-13,17,19,22H,1,8-9,14-16H2,(H,24,26)/t17?,19?,22-/m1/s1 |
| InChIKey | CAJYPMVZVWBNBZ-RKOYOZNISA-N |
| XLogP | 3.99 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.54 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|