C20H22N2O3S — CID 11899057
4-(benzenesulfonamido)-N-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]benzamide (PubChem CID 11899057) has the molecular formula C20H22N2O3S and a molecular weight of 370.47 g/mol. Its IUPAC name is 4-(benzenesulfonamido)-N-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]benzamide.
| Compound Name | 4-(benzenesulfonamido)-N-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]benzamide |
|---|---|
| PubChem CID | 11899057 |
| Molecular Formula | C20H22N2O3S |
| Molecular Weight | 370.47 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | 4-(benzenesulfonamido)-N-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]benzamide |
| SMILES | O=C(N[C@@H]1C[C@H]2CC[C@@H]1C2)c1ccc(NS(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C20H22N2O3S/c23-20(21-19-13-14-6-7-16(19)12-14)15-8-10-17(11-9-15)22-26(24,25)18-4-2-1-3-5-18/h1-5,8-11,14,16,19,22H,6-7,12-13H2,(H,21,23)/t14-,16+,19+/m0/s1 |
| InChIKey | OAROCCNGUOCXRI-ZSZQSSIHSA-N |
| XLogP | 3.41 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.47 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |