C20H21ClN2O3S — CID 125042197
4-(benzenesulfonamido)-N-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]-3-chlorobenzamide (PubChem CID 125042197) has the molecular formula C20H21ClN2O3S and a molecular weight of 404.92 g/mol. Its IUPAC name is 4-(benzenesulfonamido)-N-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]-3-chlorobenzamide.
| Compound Name | 4-(benzenesulfonamido)-N-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]-3-chlorobenzamide |
|---|---|
| PubChem CID | 125042197 |
| Molecular Formula | C20H21ClN2O3S |
| Molecular Weight | 404.92 g/mol |
| Exact Mass | 404.10 |
| IUPAC Name | 4-(benzenesulfonamido)-N-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]-3-chlorobenzamide |
| SMILES | O=C(N[C@H]1C[C@H]2CC[C@H]1C2)c1ccc(NS(=O)(=O)c2ccccc2)c(Cl)c1 |
| InChI | InChI=1S/C20H21ClN2O3S/c21-17-12-15(20(24)22-19-11-13-6-7-14(19)10-13)8-9-18(17)23-27(25,26)16-4-2-1-3-5-16/h1-5,8-9,12-14,19,23H,6-7,10-11H2,(H,22,24)/t13-,14-,19-/m0/s1 |
| InChIKey | SXLSLCSDYSNVOS-NJSLBKSFSA-N |
| XLogP | 4.06 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.92 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |