C19H25ClN2O3S — CID 21174681
N-[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]-4-chloro-3-piperidin-1-ylsulfonylbenzamide (PubChem CID 21174681) has the molecular formula C19H25ClN2O3S and a molecular weight of 396.94 g/mol. Its IUPAC name is N-[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]-4-chloro-3-piperidin-1-ylsulfonylbenzamide.
| Compound Name | N-[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]-4-chloro-3-piperidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 21174681 |
| Molecular Formula | C19H25ClN2O3S |
| Molecular Weight | 396.94 g/mol |
| Exact Mass | 396.13 |
| IUPAC Name | N-[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]-4-chloro-3-piperidin-1-ylsulfonylbenzamide |
| SMILES | O=C(N[C@@H]1C[C@@H]2CC[C@@H]1C2)c1ccc(Cl)c(S(=O)(=O)N2CCCCC2)c1 |
| InChI | InChI=1S/C19H25ClN2O3S/c20-16-7-6-15(19(23)21-17-11-13-4-5-14(17)10-13)12-18(16)26(24,25)22-8-2-1-3-9-22/h6-7,12-14,17H,1-5,8-11H2,(H,21,23)/t13-,14-,17-/m1/s1 |
| InChIKey | YQPSGTIMIBYNDU-CKEIUWERSA-N |
| XLogP | 3.43 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.94 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |