C19H27N3O4S — CID 16734117
N-(2-bicyclo[2.2.1]heptanyl)-4-(methylamino)-3-morpholin-4-ylsulfonylbenzamide (PubChem CID 16734117) has the molecular formula C19H27N3O4S and a molecular weight of 393.51 g/mol. Its IUPAC name is N-(2-bicyclo[2.2.1]heptanyl)-4-(methylamino)-3-morpholin-4-ylsulfonylbenzamide.
| Compound Name | N-(2-bicyclo[2.2.1]heptanyl)-4-(methylamino)-3-morpholin-4-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 16734117 |
| Molecular Formula | C19H27N3O4S |
| Molecular Weight | 393.51 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | N-(2-bicyclo[2.2.1]heptanyl)-4-(methylamino)-3-morpholin-4-ylsulfonylbenzamide |
| SMILES | CNc1ccc(C(=O)NC2CC3CCC2C3)cc1S(=O)(=O)N1CCOCC1 |
| InChI | InChI=1S/C19H27N3O4S/c1-20-16-5-4-15(19(23)21-17-11-13-2-3-14(17)10-13)12-18(16)27(24,25)22-6-8-26-9-7-22/h4-5,12-14,17,20H,2-3,6-11H2,1H3,(H,21,23) |
| InChIKey | AUSCHIUODPHRIR-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.51 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |