C15H20N2O3S — CID 100619770
N-[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]-3-(methylsulfamoyl)benzamide (PubChem CID 100619770) has the molecular formula C15H20N2O3S and a molecular weight of 308.40 g/mol. Its IUPAC name is N-[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]-3-(methylsulfamoyl)benzamide.
| Compound Name | N-[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]-3-(methylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 100619770 |
| Molecular Formula | C15H20N2O3S |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | N-[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]-3-(methylsulfamoyl)benzamide |
| SMILES | CNS(=O)(=O)c1cccc(C(=O)N[C@@H]2C[C@@H]3CC[C@@H]2C3)c1 |
| InChI | InChI=1S/C15H20N2O3S/c1-16-21(19,20)13-4-2-3-12(9-13)15(18)17-14-8-10-5-6-11(14)7-10/h2-4,9-11,14,16H,5-8H2,1H3,(H,17,18)/t10-,11-,14-/m1/s1 |
| InChIKey | XHUPVKVROUVSKK-JTNHKYCSSA-N |
| XLogP | 1.51 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.40 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |