C14H16FNO — CID 100580644
N-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]-3-fluorobenzamide (PubChem CID 100580644) has the molecular formula C14H16FNO and a molecular weight of 233.29 g/mol. Its IUPAC name is N-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]-3-fluorobenzamide.
| Compound Name | N-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]-3-fluorobenzamide |
|---|---|
| PubChem CID | 100580644 |
| Molecular Formula | C14H16FNO |
| Molecular Weight | 233.29 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | N-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]-3-fluorobenzamide |
| SMILES | O=C(N[C@H]1C[C@H]2CC[C@H]1C2)c1cccc(F)c1 |
| InChI | InChI=1S/C14H16FNO/c15-12-3-1-2-11(8-12)14(17)16-13-7-9-4-5-10(13)6-9/h1-3,8-10,13H,4-7H2,(H,16,17)/t9-,10-,13-/m0/s1 |
| InChIKey | ZWRYVQGTGWLIQN-KWBADKCTSA-N |
| XLogP | 2.74 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.29 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |