C12H14FNO2 — CID 40605325
3-fluoro-N-[(1R,2R)-2-hydroxycyclopentyl]benzamide (PubChem CID 40605325) has the molecular formula C12H14FNO2 and a molecular weight of 223.25 g/mol. Its IUPAC name is 3-fluoro-N-[(1R,2R)-2-hydroxycyclopentyl]benzamide.
| Compound Name | 3-fluoro-N-[(1R,2R)-2-hydroxycyclopentyl]benzamide |
|---|---|
| PubChem CID | 40605325 |
| Molecular Formula | C12H14FNO2 |
| Molecular Weight | 223.25 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | 3-fluoro-N-[(1R,2R)-2-hydroxycyclopentyl]benzamide |
| SMILES | O=C(N[C@@H]1CCC[C@H]1O)c1cccc(F)c1 |
| InChI | InChI=1S/C12H14FNO2/c13-9-4-1-3-8(7-9)12(16)14-10-5-2-6-11(10)15/h1,3-4,7,10-11,15H,2,5-6H2,(H,14,16)/t10-,11-/m1/s1 |
| InChIKey | AOCOGSOKPSLRBO-GHMZBOCLSA-N |
| XLogP | 1.47 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.25 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |