C12H15NO2 — CID 36691439
N-[(1R,2R)-2-hydroxycyclopentyl]benzamide (PubChem CID 36691439) has the molecular formula C12H15NO2 and a molecular weight of 205.26 g/mol. Its IUPAC name is N-[(1R,2R)-2-hydroxycyclopentyl]benzamide.
| Compound Name | N-[(1R,2R)-2-hydroxycyclopentyl]benzamide |
|---|---|
| PubChem CID | 36691439 |
| Molecular Formula | C12H15NO2 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | N-[(1R,2R)-2-hydroxycyclopentyl]benzamide |
| SMILES | O=C(N[C@@H]1CCC[C@H]1O)c1ccccc1 |
| InChI | InChI=1S/C12H15NO2/c14-11-8-4-7-10(11)13-12(15)9-5-2-1-3-6-9/h1-3,5-6,10-11,14H,4,7-8H2,(H,13,15)/t10-,11-/m1/s1 |
| InChIKey | YFOYMHATNNPFJC-GHMZBOCLSA-N |
| XLogP | 1.33 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |