C12H16N2O2 — CID 15096814
N-[(3R,4S)-3-hydroxypiperidin-4-yl]benzamide (PubChem CID 15096814) has the molecular formula C12H16N2O2 and a molecular weight of 220.27 g/mol. Its IUPAC name is N-[(3R,4S)-3-hydroxypiperidin-4-yl]benzamide.
| Compound Name | N-[(3R,4S)-3-hydroxypiperidin-4-yl]benzamide |
|---|---|
| PubChem CID | 15096814 |
| Molecular Formula | C12H16N2O2 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.12 |
| IUPAC Name | N-[(3R,4S)-3-hydroxypiperidin-4-yl]benzamide |
| SMILES | O=C(N[C@H]1CCNC[C@H]1O)c1ccccc1 |
| InChI | InChI=1S/C12H16N2O2/c15-11-8-13-7-6-10(11)14-12(16)9-4-2-1-3-5-9/h1-5,10-11,13,15H,6-8H2,(H,14,16)/t10-,11+/m0/s1 |
| InChIKey | OQYITJFGEOOJPO-WDEREUQCSA-N |
| XLogP | 0.14 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |