C19H22N2O4S — CID 70708699
2-benzylsulfonyl-N-[(3R,4R)-3-hydroxypiperidin-4-yl]benzamide (PubChem CID 70708699) has the molecular formula C19H22N2O4S and a molecular weight of 374.46 g/mol. Its IUPAC name is 2-benzylsulfonyl-N-[(3R,4R)-3-hydroxypiperidin-4-yl]benzamide.
| Compound Name | 2-benzylsulfonyl-N-[(3R,4R)-3-hydroxypiperidin-4-yl]benzamide |
|---|---|
| PubChem CID | 70708699 |
| Molecular Formula | C19H22N2O4S |
| Molecular Weight | 374.46 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | 2-benzylsulfonyl-N-[(3R,4R)-3-hydroxypiperidin-4-yl]benzamide |
| SMILES | O=C(N[C@@H]1CCNC[C@H]1O)c1ccccc1S(=O)(=O)Cc1ccccc1 |
| InChI | InChI=1S/C19H22N2O4S/c22-17-12-20-11-10-16(17)21-19(23)15-8-4-5-9-18(15)26(24,25)13-14-6-2-1-3-7-14/h1-9,16-17,20,22H,10-13H2,(H,21,23)/t16-,17-/m1/s1 |
| InChIKey | GMZZSXVHRDLJCU-IAGOWNOFSA-N |
| XLogP | 1.11 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.46 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |