About 2-benzylsulfonylbenzoic acid
2-benzylsulfonylbenzoic acid (PubChem CID 561426) has the molecular formula C14H12O4S
and a molecular weight of 276.31 g/mol. Its IUPAC name is 2-benzylsulfonylbenzoic acid.
Molecular Properties
| Compound Name | 2-benzylsulfonylbenzoic acid |
| PubChem CID | 561426 |
| Molecular Formula | C14H12O4S |
| Molecular Weight | 276.31 g/mol |
| Exact Mass | 276.05 |
| IUPAC Name | 2-benzylsulfonylbenzoic acid |
| SMILES | O=C(O)c1ccccc1S(=O)(=O)Cc1ccccc1 |
| InChI | InChI=1S/C14H12O4S/c15-14(16)12-8-4-5-9-13(12)19(17,18)10-11-6-2-1-3-7-11/h1-9H,10H2,(H,15,16) |
| InChIKey | GMVRFXQEJYYRMJ-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.31 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-benzylsulfonylbenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzylsulfonylbenzoic acid?
The IUPAC name of 2-benzylsulfonylbenzoic acid (CID 561426) is 2-benzylsulfonylbenzoic acid.
What is the SMILES notation for 2-benzylsulfonylbenzoic acid?
The canonical SMILES for 2-benzylsulfonylbenzoic acid is O=C(O)c1ccccc1S(=O)(=O)Cc1ccccc1.
What is the InChIKey of 2-benzylsulfonylbenzoic acid?
The InChIKey is GMVRFXQEJYYRMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12O4S/c15-14(16)12-8-4-5-9-13(12)19(17,18)10-11-6-2-1-3-7-11/h1-9H,10H2,(H,15,16).
What are the key properties of 2-benzylsulfonylbenzoic acid?
2-benzylsulfonylbenzoic acid has a molecular weight of 276.31 g/mol, XLogP of 2.36, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzylsulfonylbenzoic acid is sourced from PubChem (CID 561426), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).